Index of /Products/Large
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | 3.-JSW-factory,-Vija..> | 2024-02-09 21:11 | 247K | |
![[IMG]](/icons/image2.gif) | Another family photo..> | 2024-02-09 21:11 | 40K | |
![[IMG]](/icons/image2.gif) | Bharat-Milap,-2015,-..> | 2024-02-10 10:59 | 391K | |
![[IMG]](/icons/image2.gif) | Boy staring at an or..> | 2024-02-09 21:11 | 148K | |
![[IMG]](/icons/image2.gif) | Camel-train,-Pushkar..> | 2024-02-09 21:12 | 435K | |
![[IMG]](/icons/image2.gif) | Child-in-cot,-Rajast..> | 2024-02-09 21:12 | 405K | |
![[IMG]](/icons/image2.gif) | Children_of_the_moun..> | 2024-02-09 21:12 | 912K | |
![[IMG]](/icons/image2.gif) | Construciton-site,-R..> | 2024-02-09 21:12 | 349K | |
![[IMG]](/icons/image2.gif) | Cub-showing-affectio..> | 2024-02-09 21:12 | 1.0M | |
![[IMG]](/icons/image2.gif) | Earrings.png | 2024-02-09 21:12 | 1.1M | |
![[IMG]](/icons/image2.gif) | Fake-watch,-Mumbai.png | 2024-02-09 21:12 | 254K | |
![[IMG]](/icons/image2.gif) | Family-photo,-Chenna..> | 2024-02-09 21:12 | 219K | |
![[IMG]](/icons/image2.gif) | Family-photograph,-C..> | 2024-02-09 21:12 | 323K | |
![[IMG]](/icons/image2.gif) | Father-and-son,-Mumb..> | 2024-02-09 21:12 | 1.0M | |
![[IMG]](/icons/image2.gif) | First-snowfall-conti..> | 2024-02-09 21:13 | 1.1M | |
![[IMG]](/icons/image2.gif) | First-snowfall-of-th..> | 2024-02-09 21:12 | 1.1M | |
![[IMG]](/icons/image2.gif) | Fisheye tiger.png | 2024-02-09 21:13 | 140K | |
![[IMG]](/icons/image2.gif) | Game-of-catch,-Malan..> | 2024-02-09 21:13 | 345K | |
![[IMG]](/icons/image2.gif) | Group of boys in an ..> | 2024-02-09 21:13 | 86K | |
![[IMG]](/icons/image2.gif) | Hands.png | 2024-02-09 21:13 | 403K | |
![[IMG]](/icons/image2.gif) | Harmony,-Pushkar-Fai..> | 2024-02-09 21:13 | 479K | |
![[IMG]](/icons/image2.gif) | Jallikattu,-2017,-Al..> | 2024-02-09 21:13 | 607K | |
![[IMG]](/icons/image2.gif) | Jumping tiger in fis..> | 2024-02-09 21:13 | 88K | |
![[IMG]](/icons/image2.gif) | Langur-feet.png | 2024-02-09 21:13 | 660K | |
![[IMG]](/icons/image2.gif) | Langur-infant,-Ranth..> | 2024-02-09 21:13 | 754K | |
![[IMG]](/icons/image2.gif) | Langur_s-fighting,-T..> | 2024-02-09 21:13 | 344K | |
![[IMG]](/icons/image2.gif) | Langur_s-looking-at-..> | 2024-02-09 21:13 | 463K | |
![[IMG]](/icons/image2.gif) | Langur_s after lunch..> | 2024-02-09 21:13 | 86K | |
![[IMG]](/icons/image2.gif) | Meditating-langur.png | 2024-02-09 21:13 | 580K | |
![[IMG]](/icons/image2.gif) | Monitor lizard, Rant..> | 2024-02-09 21:13 | 50K | |
![[IMG]](/icons/image2.gif) | Mukti Bhawan (death ..> | 2024-02-09 21:13 | 105K | |
![[IMG]](/icons/image2.gif) | Mundan ceremony, Var..> | 2024-02-09 21:13 | 59K | |
![[IMG]](/icons/image2.gif) | Peacock, Ranthambhor..> | 2024-02-09 21:13 | 127K | |
![[IMG]](/icons/image2.gif) | Portrai-of-a-cub,-Ta..> | 2024-02-09 21:14 | 566K | |
![[IMG]](/icons/image2.gif) | Portrait-of-a-cub,-R..> | 2024-02-09 21:15 | 503K | |
![[IMG]](/icons/image2.gif) | Portrait-of-a-friend..> | 2024-02-09 21:14 | 561K | |
![[IMG]](/icons/image2.gif) | Pushkar-Fair,-Rajast..> | 2024-02-09 21:14 | 589K | |
![[IMG]](/icons/image2.gif) | Rituals,-Varanasi.png | 2024-02-09 21:15 | 641K | |
![[IMG]](/icons/image2.gif) | Sapphire-on-white.png | 2024-02-09 21:15 | 160K | |
![[IMG]](/icons/image2.gif) | Sarus-pair-with-deer..> | 2024-02-09 21:15 | 442K | |
![[IMG]](/icons/image2.gif) | Seaside,-Mumbai.png | 2024-02-09 21:15 | 518K | |
![[IMG]](/icons/image2.gif) | Security-guard,-Mumb..> | 2024-02-09 21:15 | 1.0M | |
![[IMG]](/icons/image2.gif) | Temple-entrance,-Var..> | 2024-02-09 21:15 | 381K | |
![[IMG]](/icons/image2.gif) | Tiger Cub, Tadoba Na..> | 2024-02-09 21:15 | 165K | |
![[IMG]](/icons/image2.gif) | Tigeress-with-cub-in..> | 2024-02-09 21:16 | 542K | |
![[IMG]](/icons/image2.gif) | Tiger hunting boar, ..> | 2024-02-09 21:15 | 199K | |
![[IMG]](/icons/image2.gif) | Tiger in grass, Rant..> | 2024-02-09 21:15 | 164K | |
![[IMG]](/icons/image2.gif) | Tigress-crossing-lak..> | 2024-02-09 21:16 | 368K | |
![[IMG]](/icons/image2.gif) | Tigress-with-cub,-Ra..> | 2024-02-09 21:16 | 427K | |
![[IMG]](/icons/image2.gif) | Tigress-with-fawn-ki..> | 2024-02-09 21:16 | 449K | |
![[IMG]](/icons/image2.gif) | Tigress-with-piglet-..> | 2024-02-09 21:16 | 532K | |
![[IMG]](/icons/image2.gif) | Tigress Maya with cu..> | 2024-02-09 21:16 | 112K | |
![[IMG]](/icons/image2.gif) | Tigress is sun, Rant..> | 2024-02-09 21:16 | 146K | |
![[IMG]](/icons/image2.gif) | Traffic-in-motion,-M..> | 2024-02-09 21:16 | 897K | |
![[IMG]](/icons/image2.gif) | Traveller,-Varanasi.png | 2024-02-09 21:16 | 332K | |
![[IMG]](/icons/image2.gif) | Triund,-Dharamkot.png | 2024-02-09 21:17 | 467K | |
![[IMG]](/icons/image2.gif) | Valley-view,-Dharamk..> | 2024-02-09 21:17 | 419K | |
![[IMG]](/icons/image2.gif) | Village classroom, P..> | 2024-02-09 21:17 | 91K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2024-..> | 2024-02-10 10:53 | 103K | |
![[IMG]](/icons/image2.gif) | Woman-preparing-mawa..> | 2024-02-09 21:17 | 709K | |
![[IMG]](/icons/image2.gif) | Woman-with-child-in-..> | 2024-02-09 21:17 | 258K | |
![[IMG]](/icons/image2.gif) | Young.png | 2024-02-09 21:17 | 127K | |
![[IMG]](/icons/image2.gif) | banner.jpg | 2024-02-09 21:11 | 549K | |
![[IMG]](/icons/image2.gif) | corporate.png | 2024-02-09 21:12 | 1.6M | |
![[IMG]](/icons/image2.gif) | events.jpg | 2024-02-09 21:12 | 109K | |
![[IMG]](/icons/image2.gif) | everyday.jpg | 2024-02-09 21:12 | 66K | |
![[IMG]](/icons/image2.gif) | film.jpg | 2024-02-10 10:54 | 103K | |
![[IMG]](/icons/image2.gif) | tiger.jpg | 2024-02-09 21:16 | 324K | |
![[IMG]](/icons/image2.gif) | varun1.jpg | 2024-02-10 20:51 | 86K | |
![[IMG]](/icons/image2.gif) | wildlife.jpg | 2024-02-09 21:17 | 131K | |
![[IMG]](/icons/image2.gif) | wildlife.png | 2024-02-10 10:57 | 545K | |
|